C8H12O3 — CID 174994759
2-methylbuta-1,3-dienyl 2-hydroxypropanoate (PubChem CID 174994759) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-methylbuta-1,3-dienyl 2-hydroxypropanoate.
| Compound Name | 2-methylbuta-1,3-dienyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 174994759 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2-methylbuta-1,3-dienyl 2-hydroxypropanoate |
| SMILES | C=CC(C)=COC(=O)C(C)O |
| InChI | InChI=1S/C8H12O3/c1-4-6(2)5-11-8(10)7(3)9/h4-5,7,9H,1H2,2-3H3 |
| InChIKey | VRVMQJXRKCPYMZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|