About 2-methylbuta-1,3-dienyl 2-hydroxypropanoate
2-methylbuta-1,3-dienyl 2-hydroxypropanoate (PubChem CID 174994759) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-methylbuta-1,3-dienyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 2-methylbuta-1,3-dienyl 2-hydroxypropanoate |
| PubChem CID | 174994759 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2-methylbuta-1,3-dienyl 2-hydroxypropanoate |
| SMILES | C=CC(C)=COC(=O)C(C)O |
| InChI | InChI=1S/C8H12O3/c1-4-6(2)5-11-8(10)7(3)9/h4-5,7,9H,1H2,2-3H3 |
| InChIKey | VRVMQJXRKCPYMZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbuta-1,3-dienyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbuta-1,3-dienyl 2-hydroxypropanoate?
The IUPAC name of 2-methylbuta-1,3-dienyl 2-hydroxypropanoate (CID 174994759) is 2-methylbuta-1,3-dienyl 2-hydroxypropanoate.
What is the SMILES notation for 2-methylbuta-1,3-dienyl 2-hydroxypropanoate?
The canonical SMILES for 2-methylbuta-1,3-dienyl 2-hydroxypropanoate is C=CC(C)=COC(=O)C(C)O.
What is the InChIKey of 2-methylbuta-1,3-dienyl 2-hydroxypropanoate?
The InChIKey is VRVMQJXRKCPYMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-4-6(2)5-11-8(10)7(3)9/h4-5,7,9H,1H2,2-3H3.
What are the key properties of 2-methylbuta-1,3-dienyl 2-hydroxypropanoate?
2-methylbuta-1,3-dienyl 2-hydroxypropanoate has a molecular weight of 156.18 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbuta-1,3-dienyl 2-hydroxypropanoate is sourced from PubChem (CID 174994759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).