C8H13NO2S — CID 174527296
2-methylbuta-1,3-dienyl (2R)-2-amino-3-sulfanylpropanoate (PubChem CID 174527296) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 2-methylbuta-1,3-dienyl (2R)-2-amino-3-sulfanylpropanoate.
| Compound Name | 2-methylbuta-1,3-dienyl (2R)-2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 174527296 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 2-methylbuta-1,3-dienyl (2R)-2-amino-3-sulfanylpropanoate |
| SMILES | C=CC(C)=COC(=O)[C@@H](N)CS |
| InChI | InChI=1S/C8H13NO2S/c1-3-6(2)4-11-8(10)7(9)5-12/h3-4,7,12H,1,5,9H2,2H3/t7-/m0/s1 |
| InChIKey | OITYWJRXOCORDL-ZETCQYMHSA-N |
| XLogP | 0.88 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|