About ethene;ethenyl acetate;2-hydroxypropanoic acid
ethene;ethenyl acetate;2-hydroxypropanoic acid (PubChem CID 174695365) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is ethene;ethenyl acetate;2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | ethene;ethenyl acetate;2-hydroxypropanoic acid |
| PubChem CID | 174695365 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | ethene;ethenyl acetate;2-hydroxypropanoic acid |
| SMILES | C=C.C=COC(C)=O.CC(O)C(=O)O |
| InChI | InChI=1S/C4H6O2.C3H6O3.C2H4/c1-3-6-4(2)5;1-2(4)3(5)6;1-2/h3H,1H2,2H3;2,4H,1H3,(H,5,6);1-2H2 |
| InChIKey | HUUANXQWMAZLDN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;ethenyl acetate;2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;ethenyl acetate;2-hydroxypropanoic acid?
The IUPAC name of ethene;ethenyl acetate;2-hydroxypropanoic acid (CID 174695365) is ethene;ethenyl acetate;2-hydroxypropanoic acid.
What is the SMILES notation for ethene;ethenyl acetate;2-hydroxypropanoic acid?
The canonical SMILES for ethene;ethenyl acetate;2-hydroxypropanoic acid is C=C.C=COC(C)=O.CC(O)C(=O)O.
What is the InChIKey of ethene;ethenyl acetate;2-hydroxypropanoic acid?
The InChIKey is HUUANXQWMAZLDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C3H6O3.C2H4/c1-3-6-4(2)5;1-2(4)3(5)6;1-2/h3H,1H2,2H3;2,4H,1H3,(H,5,6);1-2H2.
What are the key properties of ethene;ethenyl acetate;2-hydroxypropanoic acid?
ethene;ethenyl acetate;2-hydroxypropanoic acid has a molecular weight of 204.22 g/mol, XLogP of 0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;ethenyl acetate;2-hydroxypropanoic acid is sourced from PubChem (CID 174695365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).