C12H14BrNOS — CID 166067065
3-(5-bromo-1,3-benzothiazol-2-yl)-3-methylbutan-2-ol (PubChem CID 166067065) has the molecular formula C12H14BrNOS and a molecular weight of 300.22 g/mol. Its IUPAC name is 3-(5-bromo-1,3-benzothiazol-2-yl)-3-methylbutan-2-ol.
| Compound Name | 3-(5-bromo-1,3-benzothiazol-2-yl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 166067065 |
| Molecular Formula | C12H14BrNOS |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 3-(5-bromo-1,3-benzothiazol-2-yl)-3-methylbutan-2-ol |
| SMILES | CC(O)C(C)(C)c1nc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C12H14BrNOS/c1-7(15)12(2,3)11-14-9-6-8(13)4-5-10(9)16-11/h4-7,15H,1-3H3 |
| InChIKey | LMFINZZPNVBZKV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |