C11H12BrNS3 — CID 71562689
5-bromo-2-(butan-2-yldisulfanyl)-1,3-benzothiazole (PubChem CID 71562689) has the molecular formula C11H12BrNS3 and a molecular weight of 334.33 g/mol. Its IUPAC name is 5-bromo-2-(butan-2-yldisulfanyl)-1,3-benzothiazole.
| Compound Name | 5-bromo-2-(butan-2-yldisulfanyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 71562689 |
| Molecular Formula | C11H12BrNS3 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 332.93 |
| IUPAC Name | 5-bromo-2-(butan-2-yldisulfanyl)-1,3-benzothiazole |
| SMILES | CCC(C)SSc1nc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C11H12BrNS3/c1-3-7(2)15-16-11-13-9-6-8(12)4-5-10(9)14-11/h4-7H,3H2,1-2H3 |
| InChIKey | XMHKMGRUQFLFRJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|