C25H34N2O4 — CID 166075366
[3-(1H-imidazol-5-ylmethyl)-2-methylphenyl]methyl (E)-3-(acetyloxymethyl)-2-ethyl-5-methylhept-5-enoate (PubChem CID 166075366) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is [3-(1H-imidazol-5-ylmethyl)-2-methylphenyl]methyl (E)-3-(acetyloxymethyl)-2-ethyl-5-methylhept-5-enoate.
| Compound Name | [3-(1H-imidazol-5-ylmethyl)-2-methylphenyl]methyl (E)-3-(acetyloxymethyl)-2-ethyl-5-methylhept-5-enoate |
|---|---|
| PubChem CID | 166075366 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | [3-(1H-imidazol-5-ylmethyl)-2-methylphenyl]methyl (E)-3-(acetyloxymethyl)-2-ethyl-5-methylhept-5-enoate |
| SMILES | C/C=C(\C)CC(COC(C)=O)C(CC)C(=O)OCc1cccc(Cc2cnc[nH]2)c1C |
| InChI | InChI=1S/C25H34N2O4/c1-6-17(3)11-22(15-30-19(5)28)24(7-2)25(29)31-14-21-10-8-9-20(18(21)4)12-23-13-26-16-27-23/h6,8-10,13,16,22,24H,7,11-12,14-15H2,1-5H3,(H,26,27)/b17-6+ |
| InChIKey | ALDVMBLINXZANA-UBKPWBPPSA-N |
| XLogP | 4.91 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|