C12H10O3 — CID 166086128
1,2-dihydrobenzo[g][1,2,3]benzotrioxepine (PubChem CID 166086128) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 1,2-dihydrobenzo[g][1,2,3]benzotrioxepine.
| Compound Name | 1,2-dihydrobenzo[g][1,2,3]benzotrioxepine |
|---|---|
| PubChem CID | 166086128 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 1,2-dihydrobenzo[g][1,2,3]benzotrioxepine |
| SMILES | c1ccc2c3c(ccc2c1)OOOCC3 |
| InChI | InChI=1S/C12H10O3/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-15-14-12/h1-6H,7-8H2 |
| InChIKey | ZVWDAXYSTKNULQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|