C26H24N4O5 — CID 166086290
1-[3-[4-[5-(furan-2-yl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxyazetidin-1-yl]prop-2-en-1-one (PubChem CID 166086290) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is 1-[3-[4-[5-(furan-2-yl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxyazetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-[5-(furan-2-yl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxyazetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166086290 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1-[3-[4-[5-(furan-2-yl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxyazetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(Oc2cc3c(Nc4cc(-c5ccco5)ccc4OC)ncnc3cc2OC)C1 |
| InChI | InChI=1S/C26H24N4O5/c1-4-25(31)30-13-17(14-30)35-24-11-18-19(12-23(24)33-3)27-15-28-26(18)29-20-10-16(7-8-22(20)32-2)21-6-5-9-34-21/h4-12,15,17H,1,13-14H2,2-3H3,(H,27,28,29) |
| InChIKey | LFMJUKYAZBESOI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 98.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|