C34H40N6O5 — CID 166086166
1-[4-[[4-[5-(furan-2-yl)-2-methoxyanilino]-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 166086166) has the molecular formula C34H40N6O5 and a molecular weight of 612.73 g/mol. Its IUPAC name is 1-[4-[[4-[5-(furan-2-yl)-2-methoxyanilino]-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[4-[5-(furan-2-yl)-2-methoxyanilino]-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166086166 |
| Molecular Formula | C34H40N6O5 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | 1-[4-[[4-[5-(furan-2-yl)-2-methoxyanilino]-7-(3-morpholin-4-ylpropoxy)quinazolin-6-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2cc3c(Nc4cc(-c5ccco5)ccc4OC)ncnc3cc2OCCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C34H40N6O5/c1-3-33(41)40-12-9-25(10-13-40)37-29-21-26-27(22-32(29)45-17-5-11-39-14-18-43-19-15-39)35-23-36-34(26)38-28-20-24(7-8-31(28)42-2)30-6-4-16-44-30/h3-4,6-8,16,20-23,25,37H,1,5,9-15,17-19H2,2H3,(H,35,36,38) |
| InChIKey | GFVVDLXDLBMSEZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|