C28H27FN4O5 — CID 166086190
2-fluoro-1-[4-[4-[5-(furan-2-yl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 166086190) has the molecular formula C28H27FN4O5 and a molecular weight of 518.55 g/mol. Its IUPAC name is 2-fluoro-1-[4-[4-[5-(furan-2-yl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 2-fluoro-1-[4-[4-[5-(furan-2-yl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166086190 |
| Molecular Formula | C28H27FN4O5 |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 2-fluoro-1-[4-[4-[5-(furan-2-yl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CCC(Oc2cc3c(Nc4cc(-c5ccco5)ccc4OC)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C28H27FN4O5/c1-17(29)28(34)33-10-8-19(9-11-33)38-26-14-20-21(15-25(26)36-3)30-16-31-27(20)32-22-13-18(6-7-24(22)35-2)23-5-4-12-37-23/h4-7,12-16,19H,1,8-11H2,2-3H3,(H,30,31,32) |
| InChIKey | PQOMIYWHTUEYNN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 98.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|