C24H21F3N4O2 — CID 166099925
[(1S,9S)-6-(2-pyrimidin-5-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 166099925) has the molecular formula C24H21F3N4O2 and a molecular weight of 454.45 g/mol. Its IUPAC name is [(1S,9S)-6-(2-pyrimidin-5-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | [(1S,9S)-6-(2-pyrimidin-5-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 166099925 |
| Molecular Formula | C24H21F3N4O2 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | [(1S,9S)-6-(2-pyrimidin-5-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | O=C(N1C[C@@H]2C[C@H]1c1cncc(C#Cc3cncnc3)c1O2)C12CCC(C(F)(F)F)(CC1)C2 |
| InChI | InChI=1S/C24H21F3N4O2/c25-24(26,27)23-5-3-22(13-23,4-6-23)21(32)31-12-17-7-19(31)18-11-28-10-16(20(18)33-17)2-1-15-8-29-14-30-9-15/h8-11,14,17,19H,3-7,12-13H2/t17-,19-,22?,23?/m0/s1 |
| InChIKey | LXYKQORZBNDVJA-YILSLVNCSA-N |
| XLogP | 3.82 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|