C25H21F4N3O2 — CID 166099989
[(1S,9S)-6-[2-(5-fluoro-3-pyridinyl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 166099989) has the molecular formula C25H21F4N3O2 and a molecular weight of 471.45 g/mol. Its IUPAC name is [(1S,9S)-6-[2-(5-fluoro-3-pyridinyl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | [(1S,9S)-6-[2-(5-fluoro-3-pyridinyl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 166099989 |
| Molecular Formula | C25H21F4N3O2 |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | [(1S,9S)-6-[2-(5-fluoro-3-pyridinyl)ethynyl]-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | O=C(N1C[C@@H]2C[C@H]1c1cncc(C#Cc3cncc(F)c3)c1O2)C12CCC(C(F)(F)F)(CC1)C2 |
| InChI | InChI=1S/C25H21F4N3O2/c26-17-7-15(9-30-11-17)1-2-16-10-31-12-19-20-8-18(34-21(16)19)13-32(20)22(33)23-3-5-24(14-23,6-4-23)25(27,28)29/h7,9-12,18,20H,3-6,8,13-14H2/t18-,20-,23?,24?/m0/s1 |
| InChIKey | LMPBEFASXOMHOI-YMZJCOOUSA-N |
| XLogP | 4.56 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|