C25H22F3N3O2 — CID 171761395
[(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 171761395) has the molecular formula C25H22F3N3O2 and a molecular weight of 453.46 g/mol. Its IUPAC name is [(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | [(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 171761395 |
| Molecular Formula | C25H22F3N3O2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | [(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]-[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | O=C(N1C[C@@H]2C[C@H]1c1cncc(C#Cc3cccnc3)c1O2)C12CCC(C(F)(F)F)(CC1)C2 |
| InChI | InChI=1S/C25H22F3N3O2/c26-25(27,28)24-7-5-23(15-24,6-8-24)22(32)31-14-18-10-20(31)19-13-30-12-17(21(19)33-18)4-3-16-2-1-9-29-11-16/h1-2,9,11-13,18,20H,5-8,10,14-15H2/t18-,20-,23?,24?/m0/s1 |
| InChIKey | BXRBMFDEYCBTCI-YMZJCOOUSA-N |
| XLogP | 4.42 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|