C24H22FN3O2 — CID 171761390
(4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone (PubChem CID 171761390) has the molecular formula C24H22FN3O2 and a molecular weight of 403.46 g/mol. Its IUPAC name is (4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone.
| Compound Name | (4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone |
|---|---|
| PubChem CID | 171761390 |
| Molecular Formula | C24H22FN3O2 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (4-fluoro-1-bicyclo[2.2.1]heptanyl)-[(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]methanone |
| SMILES | O=C(N1C[C@@H]2C[C@H]1c1cncc(C#Cc3cccnc3)c1O2)C12CCC(F)(CC1)C2 |
| InChI | InChI=1S/C24H22FN3O2/c25-24-7-5-23(15-24,6-8-24)22(29)28-14-18-10-20(28)19-13-27-12-17(21(19)30-18)4-3-16-2-1-9-26-11-16/h1-2,9,11-13,18,20H,5-8,10,14-15H2/t18-,20-,23?,24?/m0/s1 |
| InChIKey | GVHUSKGENYQQQK-YMZJCOOUSA-N |
| XLogP | 3.58 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|