C33H37ClFN5O2 — CID 166102834
5-chloro-4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-methoxy-8-methylquinazolin-7-yl]naphthalen-2-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 166102834) has the molecular formula C33H37ClFN5O2 and a molecular weight of 590.14 g/mol. Its IUPAC name is 5-chloro-4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-methoxy-8-methylquinazolin-7-yl]naphthalen-2-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 5-chloro-4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-methoxy-8-methylquinazolin-7-yl]naphthalen-2-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 166102834 |
| Molecular Formula | C33H37ClFN5O2 |
| Molecular Weight | 590.14 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | 5-chloro-4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-2-methoxy-8-methylquinazolin-7-yl]naphthalen-2-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | COc1nc(N2C3CCC2CNC3)c2ccc(-c3cc(O)cc4cccc(Cl)c34)c(C)c2n1.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C26H25ClN4O2.C7H12FN/c1-14-19(21-11-18(32)10-15-4-3-5-22(27)23(15)21)8-9-20-24(14)29-26(33-2)30-25(20)31-16-6-7-17(31)13-28-12-16;8-6-4-7-2-1-3-9(7)5-6/h3-5,8-11,16-17,28,32H,6-7,12-13H2,1-2H3;6-7H,1-5H2 |
| InChIKey | HKPYOUOOFZWCMB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.14 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |