C7H5ClF2N4 — CID 166104103
6-chloro-1-(2,2-difluoroethyl)pyrazolo[3,4-b]pyrazine (PubChem CID 166104103) has the molecular formula C7H5ClF2N4 and a molecular weight of 218.59 g/mol. Its IUPAC name is 6-chloro-1-(2,2-difluoroethyl)pyrazolo[3,4-b]pyrazine.
| Compound Name | 6-chloro-1-(2,2-difluoroethyl)pyrazolo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 166104103 |
| Molecular Formula | C7H5ClF2N4 |
| Molecular Weight | 218.59 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 6-chloro-1-(2,2-difluoroethyl)pyrazolo[3,4-b]pyrazine |
| SMILES | FC(F)Cn1ncc2ncc(Cl)nc21 |
| InChI | InChI=1S/C7H5ClF2N4/c8-5-2-11-4-1-12-14(3-6(9)10)7(4)13-5/h1-2,6H,3H2 |
| InChIKey | ISIOETSYCJVIRA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.59 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |