C18H27N3O8S — CID 166107049
tert-butyl 2-[2-[2-[(2-nitrophenyl)sulfonylamino]ethoxy]ethyl-(2-oxoethyl)amino]acetate (PubChem CID 166107049) has the molecular formula C18H27N3O8S and a molecular weight of 445.49 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[(2-nitrophenyl)sulfonylamino]ethoxy]ethyl-(2-oxoethyl)amino]acetate.
| Compound Name | tert-butyl 2-[2-[2-[(2-nitrophenyl)sulfonylamino]ethoxy]ethyl-(2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 166107049 |
| Molecular Formula | C18H27N3O8S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | tert-butyl 2-[2-[2-[(2-nitrophenyl)sulfonylamino]ethoxy]ethyl-(2-oxoethyl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(CC=O)CCOCCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H27N3O8S/c1-18(2,3)29-17(23)14-20(9-11-22)10-13-28-12-8-19-30(26,27)16-7-5-4-6-15(16)21(24)25/h4-7,11,19H,8-10,12-14H2,1-3H3 |
| InChIKey | JGUOJMNJCXLELR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|