About 2-ethylpentan-1-one;tungsten
2-ethylpentan-1-one;tungsten (PubChem CID 166120591) has the molecular formula C7H13OW-
and a molecular weight of 297.02 g/mol. Its IUPAC name is 2-ethylpentan-1-one;tungsten.
Molecular Properties
| Compound Name | 2-ethylpentan-1-one;tungsten |
| PubChem CID | 166120591 |
| Molecular Formula | C7H13OW- |
| Molecular Weight | 297.02 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-ethylpentan-1-one;tungsten |
| SMILES | CCCC([C-]=O)CC.[W] |
| InChI | InChI=1S/C7H13O.W/c1-3-5-7(4-2)6-8;/h7H,3-5H2,1-2H3;/q-1; |
| InChIKey | PPHLJEHVWHPGIE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.02 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylpentan-1-one;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpentan-1-one;tungsten?
The IUPAC name of 2-ethylpentan-1-one;tungsten (CID 166120591) is 2-ethylpentan-1-one;tungsten.
What is the SMILES notation for 2-ethylpentan-1-one;tungsten?
The canonical SMILES for 2-ethylpentan-1-one;tungsten is CCCC([C-]=O)CC.[W].
What is the InChIKey of 2-ethylpentan-1-one;tungsten?
The InChIKey is PPHLJEHVWHPGIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13O.W/c1-3-5-7(4-2)6-8;/h7H,3-5H2,1-2H3;/q-1;.
What are the key properties of 2-ethylpentan-1-one;tungsten?
2-ethylpentan-1-one;tungsten has a molecular weight of 297.02 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpentan-1-one;tungsten is sourced from PubChem (CID 166120591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).