About bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+)
bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+) (PubChem CID 175509544) has the molecular formula C16H30O4Ti
and a molecular weight of 334.28 g/mol. Its IUPAC name is bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+).
Molecular Properties
| Compound Name | bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+) |
| PubChem CID | 175509544 |
| Molecular Formula | C16H30O4Ti |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+) |
| SMILES | CCCC(O)C([C-]=O)CC.CCCC(O)C([C-]=O)CC.[Ti+2] |
| InChI | InChI=1S/2C8H15O2.Ti/c2*1-3-5-8(10)7(4-2)6-9;/h2*7-8,10H,3-5H2,1-2H3;/q2*-1;+2 |
| InChIKey | XEMMVVNUNAZQFN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+)?
The IUPAC name of bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+) (CID 175509544) is bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+).
What is the SMILES notation for bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+)?
The canonical SMILES for bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+) is CCCC(O)C([C-]=O)CC.CCCC(O)C([C-]=O)CC.[Ti+2].
What is the InChIKey of bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+)?
The InChIKey is XEMMVVNUNAZQFN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H15O2.Ti/c2*1-3-5-8(10)7(4-2)6-9;/h2*7-8,10H,3-5H2,1-2H3;/q2*-1;+2.
What are the key properties of bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+)?
bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+) has a molecular weight of 334.28 g/mol, XLogP of 2.56, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethyl-3-hydroxyhexan-1-one);titanium(2+) is sourced from PubChem (CID 175509544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).