C13H11N3O2 — CID 166133367
3-amino-5-methyl-6-phenyl-[1,2]oxazolo[4,5-c]pyridin-4-one (PubChem CID 166133367) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 3-amino-5-methyl-6-phenyl-[1,2]oxazolo[4,5-c]pyridin-4-one.
| Compound Name | 3-amino-5-methyl-6-phenyl-[1,2]oxazolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 166133367 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-amino-5-methyl-6-phenyl-[1,2]oxazolo[4,5-c]pyridin-4-one |
| SMILES | Cn1c(-c2ccccc2)cc2onc(N)c2c1=O |
| InChI | InChI=1S/C13H11N3O2/c1-16-9(8-5-3-2-4-6-8)7-10-11(13(16)17)12(14)15-18-10/h2-7H,1H3,(H2,14,15) |
| InChIKey | CCNNCGWDTBXDFF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |