C24H21BrN2O2S — CID 166137418
(5-bromobenzo[g][1]benzothiol-2-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 166137418) has the molecular formula C24H21BrN2O2S and a molecular weight of 481.42 g/mol. Its IUPAC name is (5-bromobenzo[g][1]benzothiol-2-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (5-bromobenzo[g][1]benzothiol-2-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166137418 |
| Molecular Formula | C24H21BrN2O2S |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | (5-bromobenzo[g][1]benzothiol-2-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc4cc(Br)c5ccccc5c4s3)CC2)cc1 |
| InChI | InChI=1S/C24H21BrN2O2S/c1-29-18-8-6-17(7-9-18)26-10-12-27(13-11-26)24(28)22-15-16-14-21(25)19-4-2-3-5-20(19)23(16)30-22/h2-9,14-15H,10-13H2,1H3 |
| InChIKey | MSFKDWPXGQRPTA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|