C24H21ClN2O4S2 — CID 166137479
2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzo[g][1]benzothiole-5-sulfonyl chloride (PubChem CID 166137479) has the molecular formula C24H21ClN2O4S2 and a molecular weight of 501.03 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzo[g][1]benzothiole-5-sulfonyl chloride.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzo[g][1]benzothiole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 166137479 |
| Molecular Formula | C24H21ClN2O4S2 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzo[g][1]benzothiole-5-sulfonyl chloride |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc4cc(S(=O)(=O)Cl)c5ccccc5c4s3)CC2)cc1 |
| InChI | InChI=1S/C24H21ClN2O4S2/c1-31-18-8-6-17(7-9-18)26-10-12-27(13-11-26)24(28)21-14-16-15-22(33(25,29)30)19-4-2-3-5-20(19)23(16)32-21/h2-9,14-15H,10-13H2,1H3 |
| InChIKey | JCOFYWZYRDSUFL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|