C34H68O5S5 — CID 166138255
2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate (PubChem CID 166138255) has the molecular formula C34H68O5S5 and a molecular weight of 717.25 g/mol. Its IUPAC name is 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate.
| Compound Name | 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 166138255 |
| Molecular Formula | C34H68O5S5 |
| Molecular Weight | 717.25 g/mol |
| Exact Mass | 716.37 |
| IUPAC Name | 2-[2,2-bis[8-(pentylsulfanylmethylsulfanyl)octyl]-1,3-dioxolan-4-yl]ethyl methanesulfonate |
| SMILES | CCCCCSCSCCCCCCCCC1(CCCCCCCCSCSCCCCC)OCC(CCOS(C)(=O)=O)O1 |
| InChI | InChI=1S/C34H68O5S5/c1-4-6-18-26-40-31-42-28-20-14-10-8-12-16-23-34(37-30-33(39-34)22-25-38-44(3,35)36)24-17-13-9-11-15-21-29-43-32-41-27-19-7-5-2/h33H,4-32H2,1-3H3 |
| InChIKey | BIETUYPHLJFGAE-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.25 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|