C19H35F3N4O3 — CID 166156897
N-(1-aminoethyl)formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]ethyl]acetamide (PubChem CID 166156897) has the molecular formula C19H35F3N4O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is N-(1-aminoethyl)formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]ethyl]acetamide.
| Compound Name | N-(1-aminoethyl)formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 166156897 |
| Molecular Formula | C19H35F3N4O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-(1-aminoethyl)formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]ethyl]acetamide |
| SMILES | CC(C)C.CC(N)NC=O.C[C@@H]1C2C(CN1C(=O)CNC(=O)C(F)(F)F)C2(C)C |
| InChI | InChI=1S/C12H17F3N2O2.C4H10.C3H8N2O/c1-6-9-7(11(9,2)3)5-17(6)8(18)4-16-10(19)12(13,14)15;1-4(2)3;1-3(4)5-2-6/h6-7,9H,4-5H2,1-3H3,(H,16,19);4H,1-3H3;2-3H,4H2,1H3,(H,5,6)/t6-,7?,9?;;/m1../s1 |
| InChIKey | LTSFGOVPSZGHKB-HQRYJHMPSA-N |
| XLogP | 1.87 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|