C22H20F6N4O3 — CID 166161190
(2S,3R,4R,5S)-3-[3-(difluoromethyl)-4-fluoro-2-methoxyphenyl]-4,5-dimethyl-N-(triazolo[1,5-a]pyridin-6-yl)-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166161190) has the molecular formula C22H20F6N4O3 and a molecular weight of 502.42 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3-[3-(difluoromethyl)-4-fluoro-2-methoxyphenyl]-4,5-dimethyl-N-(triazolo[1,5-a]pyridin-6-yl)-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3R,4R,5S)-3-[3-(difluoromethyl)-4-fluoro-2-methoxyphenyl]-4,5-dimethyl-N-(triazolo[1,5-a]pyridin-6-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166161190 |
| Molecular Formula | C22H20F6N4O3 |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (2S,3R,4R,5S)-3-[3-(difluoromethyl)-4-fluoro-2-methoxyphenyl]-4,5-dimethyl-N-(triazolo[1,5-a]pyridin-6-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](C(=O)Nc3ccc4cnnn4c3)O[C@](C)(C(F)(F)F)[C@@H]2C)ccc(F)c1C(F)F |
| InChI | InChI=1S/C22H20F6N4O3/c1-10-15(13-6-7-14(23)16(19(24)25)17(13)34-3)18(35-21(10,2)22(26,27)28)20(33)30-11-4-5-12-8-29-31-32(12)9-11/h4-10,15,18-19H,1-3H3,(H,30,33)/t10-,15-,18+,21+/m1/s1 |
| InChIKey | AVNNBBRVCYVSPW-JHVFAMKCSA-N |
| XLogP | 4.89 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |