C14H18AlN3O4 — CID 166161608
CID 166161608 (PubChem CID 166161608) has the molecular formula C14H18AlN3O4 and a molecular weight of 319.30 g/mol.
| Compound Name | CID 166161608 |
|---|---|
| PubChem CID | 166161608 |
| Molecular Formula | C14H18AlN3O4 |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | — |
| SMILES | CO[C@H]1[C@@H]([Al])C(C(=O)Nc2ccnc(C(N)=O)c2)OC1(C)C |
| InChI | InChI=1S/C14H18N3O4.Al/c1-14(2)11(20-3)7-10(21-14)13(19)17-8-4-5-16-9(6-8)12(15)18;/h4-7,10-11H,1-3H3,(H2,15,18)(H,16,17,19);/t10?,11-;/m0./s1 |
| InChIKey | CAUUBSQBEOYIRY-GQNCZFCYSA-N |
| XLogP | 0.27 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |