About CID 166161608
CID 166161608 (PubChem CID 166161608) has the molecular formula C14H18AlN3O4
and a molecular weight of 319.30 g/mol.
Molecular Properties
| Compound Name | CID 166161608 |
| PubChem CID | 166161608 |
| Molecular Formula | C14H18AlN3O4 |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | — |
| SMILES | CO[C@H]1[C@@H]([Al])C(C(=O)Nc2ccnc(C(N)=O)c2)OC1(C)C |
| InChI | InChI=1S/C14H18N3O4.Al/c1-14(2)11(20-3)7-10(21-14)13(19)17-8-4-5-16-9(6-8)12(15)18;/h4-7,10-11H,1-3H3,(H2,15,18)(H,16,17,19);/t10?,11-;/m0./s1 |
| InChIKey | CAUUBSQBEOYIRY-GQNCZFCYSA-N |
| XLogP | 0.27 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 166161608 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166161608?
The IUPAC name of CID 166161608 (CID 166161608) is not available.
What is the SMILES notation for CID 166161608?
The canonical SMILES for CID 166161608 is CO[C@H]1[C@@H]([Al])C(C(=O)Nc2ccnc(C(N)=O)c2)OC1(C)C.
What is the InChIKey of CID 166161608?
The InChIKey is CAUUBSQBEOYIRY-GQNCZFCYSA-N. The full InChI is InChI=1S/C14H18N3O4.Al/c1-14(2)11(20-3)7-10(21-14)13(19)17-8-4-5-16-9(6-8)12(15)18;/h4-7,10-11H,1-3H3,(H2,15,18)(H,16,17,19);/t10?,11-;/m0./s1.
What are the key properties of CID 166161608?
CID 166161608 has a molecular weight of 319.30 g/mol, XLogP of 0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166161608 is sourced from PubChem (CID 166161608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).