C19H26N2O4 — CID 166164154
[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-indol-5-yl] 2-methylbutanoate (PubChem CID 166164154) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is [2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-indol-5-yl] 2-methylbutanoate.
| Compound Name | [2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-indol-5-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 166164154 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-indol-5-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1ccc2[nH]c(CNC(=O)OC(C)(C)C)cc2c1 |
| InChI | InChI=1S/C19H26N2O4/c1-6-12(2)17(22)24-15-7-8-16-13(10-15)9-14(21-16)11-20-18(23)25-19(3,4)5/h7-10,12,21H,6,11H2,1-5H3,(H,20,23) |
| InChIKey | HZZZOZSZMYIQNI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|