C15H17F3N2O2 — CID 89136678
tert-butyl N-[dideuterio-[2-(trifluoromethyl)-1H-indol-5-yl]methyl]carbamate (PubChem CID 89136678) has the molecular formula C15H17F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is tert-butyl N-[dideuterio-[2-(trifluoromethyl)-1H-indol-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[dideuterio-[2-(trifluoromethyl)-1H-indol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 89136678 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | tert-butyl N-[dideuterio-[2-(trifluoromethyl)-1H-indol-5-yl]methyl]carbamate |
| SMILES | [2H]C([2H])(NC(=O)OC(C)(C)C)c1ccc2[nH]c(C(F)(F)F)cc2c1 |
| InChI | InChI=1S/C15H17F3N2O2/c1-14(2,3)22-13(21)19-8-9-4-5-11-10(6-9)7-12(20-11)15(16,17)18/h4-7,20H,8H2,1-3H3,(H,19,21)/i8D2 |
| InChIKey | DXYDHPDMEUMRHZ-MGVXTIMCSA-N |
| XLogP | 4.21 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |