C19H17F2N3O5S — CID 16616883
[1-(difluoromethyl)imidazol-2-yl]methyl 3-[(4-methoxyphenyl)sulfamoyl]benzoate (PubChem CID 16616883) has the molecular formula C19H17F2N3O5S and a molecular weight of 437.42 g/mol. Its IUPAC name is [1-(difluoromethyl)imidazol-2-yl]methyl 3-[(4-methoxyphenyl)sulfamoyl]benzoate.
| Compound Name | [1-(difluoromethyl)imidazol-2-yl]methyl 3-[(4-methoxyphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 16616883 |
| Molecular Formula | C19H17F2N3O5S |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | [1-(difluoromethyl)imidazol-2-yl]methyl 3-[(4-methoxyphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)OCc3nccn3C(F)F)c2)cc1 |
| InChI | InChI=1S/C19H17F2N3O5S/c1-28-15-7-5-14(6-8-15)23-30(26,27)16-4-2-3-13(11-16)18(25)29-12-17-22-9-10-24(17)19(20)21/h2-11,19,23H,12H2,1H3 |
| InChIKey | ARFQWIFYVYIQIQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |