C25H25N7O — CID 166172174
(E)-2-cyano-N,4,4-trimethyl-N-[7-(2-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]pent-2-enamide (PubChem CID 166172174) has the molecular formula C25H25N7O and a molecular weight of 439.52 g/mol. Its IUPAC name is (E)-2-cyano-N,4,4-trimethyl-N-[7-(2-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]pent-2-enamide.
| Compound Name | (E)-2-cyano-N,4,4-trimethyl-N-[7-(2-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]pent-2-enamide |
|---|---|
| PubChem CID | 166172174 |
| Molecular Formula | C25H25N7O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (E)-2-cyano-N,4,4-trimethyl-N-[7-(2-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]pent-2-enamide |
| SMILES | Cc1ccccc1Nc1nc2ccc(N(C)C(=O)/C(C#N)=C/C(C)(C)C)nc2n2cncc12 |
| InChI | InChI=1S/C25H25N7O/c1-16-8-6-7-9-18(16)28-22-20-14-27-15-32(20)23-19(29-22)10-11-21(30-23)31(5)24(33)17(13-26)12-25(2,3)4/h6-12,14-15H,1-5H3,(H,28,29)/b17-12+ |
| InChIKey | SLNXTSUMRVISPU-SFQUDFHCSA-N |
| XLogP | 4.79 |
| TPSA | 99.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|