C13H18BrFO2Si — CID 166172423
(6-bromo-8-fluoro-4-methyl-1,3-dihydroisochromen-4-yl)oxy-trimethylsilane (PubChem CID 166172423) has the molecular formula C13H18BrFO2Si and a molecular weight of 333.27 g/mol. Its IUPAC name is (6-bromo-8-fluoro-4-methyl-1,3-dihydroisochromen-4-yl)oxy-trimethylsilane.
| Compound Name | (6-bromo-8-fluoro-4-methyl-1,3-dihydroisochromen-4-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 166172423 |
| Molecular Formula | C13H18BrFO2Si |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | (6-bromo-8-fluoro-4-methyl-1,3-dihydroisochromen-4-yl)oxy-trimethylsilane |
| SMILES | CC1(O[Si](C)(C)C)COCc2c(F)cc(Br)cc21 |
| InChI | InChI=1S/C13H18BrFO2Si/c1-13(17-18(2,3)4)8-16-7-10-11(13)5-9(14)6-12(10)15/h5-6H,7-8H2,1-4H3 |
| InChIKey | VUDRSMZRVVVURQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|