C47H57N3O9 — CID 166176905
tert-butyl 4-[4-oxo-4-[[(3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]amino]butanoyl]piperazine-1-carboxylate (PubChem CID 166176905) has the molecular formula C47H57N3O9 and a molecular weight of 807.99 g/mol. Its IUPAC name is tert-butyl 4-[4-oxo-4-[[(3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]amino]butanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-oxo-4-[[(3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]amino]butanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166176905 |
| Molecular Formula | C47H57N3O9 |
| Molecular Weight | 807.99 g/mol |
| Exact Mass | 807.41 |
| IUPAC Name | tert-butyl 4-[4-oxo-4-[[(3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]amino]butanoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CCC(=O)N[C@H]2C(OCc3ccccc3)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)CC1 |
| InChI | InChI=1S/C47H57N3O9/c1-47(2,3)59-46(53)50-28-26-49(27-29-50)41(52)25-24-40(51)48-42-44(56-32-37-20-12-6-13-21-37)43(55-31-36-18-10-5-11-19-36)39(34-54-30-35-16-8-4-9-17-35)58-45(42)57-33-38-22-14-7-15-23-38/h4-23,39,42-45H,24-34H2,1-3H3,(H,48,51)/t39-,42-,43-,44-,45?/m1/s1 |
| InChIKey | XNJMUKOUOQCQAV-UXNWKBKMSA-N |
| XLogP | 6.66 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.99 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |