C16H17N5O3S — CID 166186064
1-methyl-N-[2-(5-methyl-1H-imidazol-2-yl)phenyl]-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 166186064) has the molecular formula C16H17N5O3S and a molecular weight of 359.41 g/mol. Its IUPAC name is 1-methyl-N-[2-(5-methyl-1H-imidazol-2-yl)phenyl]-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-[2-(5-methyl-1H-imidazol-2-yl)phenyl]-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 166186064 |
| Molecular Formula | C16H17N5O3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-methyl-N-[2-(5-methyl-1H-imidazol-2-yl)phenyl]-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | Cc1cnc(-c2ccccc2NC(=O)c2cc(S(N)(=O)=O)cn2C)[nH]1 |
| InChI | InChI=1S/C16H17N5O3S/c1-10-8-18-15(19-10)12-5-3-4-6-13(12)20-16(22)14-7-11(9-21(14)2)25(17,23)24/h3-9H,1-2H3,(H,18,19)(H,20,22)(H2,17,23,24) |
| InChIKey | HOMLNOVTABYRAE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |