C15H13ClN4O3S2 — CID 166189748
3-(4-chlorophenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 166189748) has the molecular formula C15H13ClN4O3S2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166189748 |
| Molecular Formula | C15H13ClN4O3S2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2cc(-c3ccc(Cl)cc3)n[nH]2)s1 |
| InChI | InChI=1S/C15H13ClN4O3S2/c16-10-3-1-9(2-4-10)12-7-13(20-19-12)15(21)18-8-11-5-6-14(24-11)25(17,22)23/h1-7H,8H2,(H,18,21)(H,19,20)(H2,17,22,23) |
| InChIKey | XNNLWAJVPHFQSA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |