C28H35NO4 — CID 166194420
N-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-(4-methoxyphenyl)adamantane-1-carboxamide (PubChem CID 166194420) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is N-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-(4-methoxyphenyl)adamantane-1-carboxamide.
| Compound Name | N-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-(4-methoxyphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 166194420 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | N-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-(4-methoxyphenyl)adamantane-1-carboxamide |
| SMILES | COc1ccc(C23CC4CC(CC(C(=O)NCC(O)COc5cccc(C)c5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C28H35NO4/c1-19-4-3-5-25(10-19)33-17-23(30)16-29-26(31)28-14-20-11-21(15-28)13-27(12-20,18-28)22-6-8-24(32-2)9-7-22/h3-10,20-21,23,30H,11-18H2,1-2H3,(H,29,31) |
| InChIKey | BHTUZXRPECIOMM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |