C15H12N4O4S — CID 166202904
N-[3-(1H-1,2,4-triazol-5-yl)phenyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 166202904) has the molecular formula C15H12N4O4S and a molecular weight of 344.35 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)phenyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)phenyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 166202904 |
| Molecular Formula | C15H12N4O4S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)phenyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2ncn[nH]2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12N4O4S/c20-24(21,12-4-5-13-14(7-12)23-9-22-13)19-11-3-1-2-10(6-11)15-16-8-17-18-15/h1-8,19H,9H2,(H,16,17,18) |
| InChIKey | DVYBHCAFTWDCAB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |