C20H17N3O4 — CID 166211201
2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl quinoxaline-5-carboxylate (PubChem CID 166211201) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl quinoxaline-5-carboxylate.
| Compound Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl quinoxaline-5-carboxylate |
|---|---|
| PubChem CID | 166211201 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl quinoxaline-5-carboxylate |
| SMILES | O=C1CCc2cc(OCCOC(=O)c3cccc4nccnc34)ccc2N1 |
| InChI | InChI=1S/C20H17N3O4/c24-18-7-4-13-12-14(5-6-16(13)23-18)26-10-11-27-20(25)15-2-1-3-17-19(15)22-9-8-21-17/h1-3,5-6,8-9,12H,4,7,10-11H2,(H,23,24) |
| InChIKey | VJCTWSWHDGTJSV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|