C17H16N2O5 — CID 56824771
2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl 2-oxo-1H-pyridine-3-carboxylate (PubChem CID 56824771) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl 2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl 2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 56824771 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl 2-oxo-1H-pyridine-3-carboxylate |
| SMILES | O=C1CCc2cc(OCCOC(=O)c3ccc[nH]c3=O)ccc2N1 |
| InChI | InChI=1S/C17H16N2O5/c20-15-6-3-11-10-12(4-5-14(11)19-15)23-8-9-24-17(22)13-2-1-7-18-16(13)21/h1-2,4-5,7,10H,3,6,8-9H2,(H,18,21)(H,19,20) |
| InChIKey | SFULYQKGIYCABS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|