C22H24ClN5O2 — CID 166213939
5-(tert-butylcarbamoylamino)-2-chloro-N-[(4-methylquinazolin-2-yl)methyl]benzamide (PubChem CID 166213939) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 5-(tert-butylcarbamoylamino)-2-chloro-N-[(4-methylquinazolin-2-yl)methyl]benzamide.
| Compound Name | 5-(tert-butylcarbamoylamino)-2-chloro-N-[(4-methylquinazolin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 166213939 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 5-(tert-butylcarbamoylamino)-2-chloro-N-[(4-methylquinazolin-2-yl)methyl]benzamide |
| SMILES | Cc1nc(CNC(=O)c2cc(NC(=O)NC(C)(C)C)ccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C22H24ClN5O2/c1-13-15-7-5-6-8-18(15)27-19(25-13)12-24-20(29)16-11-14(9-10-17(16)23)26-21(30)28-22(2,3)4/h5-11H,12H2,1-4H3,(H,24,29)(H2,26,28,30) |
| InChIKey | WQXHXQWCMFNJLK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |