C20H33NO4 — CID 166218650
1-(3-methoxy-3-methylbutyl)-4-(2,4,6-trimethoxyphenyl)piperidine (PubChem CID 166218650) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-(3-methoxy-3-methylbutyl)-4-(2,4,6-trimethoxyphenyl)piperidine.
| Compound Name | 1-(3-methoxy-3-methylbutyl)-4-(2,4,6-trimethoxyphenyl)piperidine |
|---|---|
| PubChem CID | 166218650 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 1-(3-methoxy-3-methylbutyl)-4-(2,4,6-trimethoxyphenyl)piperidine |
| SMILES | COc1cc(OC)c(C2CCN(CCC(C)(C)OC)CC2)c(OC)c1 |
| InChI | InChI=1S/C20H33NO4/c1-20(2,25-6)9-12-21-10-7-15(8-11-21)19-17(23-4)13-16(22-3)14-18(19)24-5/h13-15H,7-12H2,1-6H3 |
| InChIKey | FAXXBHXIMHTQDA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |