C18H19FN2O — CID 166232892
(Z)-N-[(4-fluorophenyl)methoxy]-3-pyridin-3-ylcyclohexan-1-imine (PubChem CID 166232892) has the molecular formula C18H19FN2O and a molecular weight of 298.36 g/mol. Its IUPAC name is (Z)-N-[(4-fluorophenyl)methoxy]-3-pyridin-3-ylcyclohexan-1-imine.
| Compound Name | (Z)-N-[(4-fluorophenyl)methoxy]-3-pyridin-3-ylcyclohexan-1-imine |
|---|---|
| PubChem CID | 166232892 |
| Molecular Formula | C18H19FN2O |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (Z)-N-[(4-fluorophenyl)methoxy]-3-pyridin-3-ylcyclohexan-1-imine |
| SMILES | Fc1ccc(CO/N=C2/CCCC(c3cccnc3)C2)cc1 |
| InChI | InChI=1S/C18H19FN2O/c19-17-8-6-14(7-9-17)13-22-21-18-5-1-3-15(11-18)16-4-2-10-20-12-16/h2,4,6-10,12,15H,1,3,5,11,13H2/b21-18- |
| InChIKey | XGOKEPUMMMAOFB-UZYVYHOESA-N |
| XLogP | 4.45 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|