C17H15F6N3O — CID 166236084
1-[2-[2-(trifluoromethyl)phenyl]ethyl]-3-[[6-(trifluoromethyl)-2-pyridinyl]methyl]urea (PubChem CID 166236084) has the molecular formula C17H15F6N3O and a molecular weight of 391.32 g/mol. Its IUPAC name is 1-[2-[2-(trifluoromethyl)phenyl]ethyl]-3-[[6-(trifluoromethyl)-2-pyridinyl]methyl]urea.
| Compound Name | 1-[2-[2-(trifluoromethyl)phenyl]ethyl]-3-[[6-(trifluoromethyl)-2-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 166236084 |
| Molecular Formula | C17H15F6N3O |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-[2-[2-(trifluoromethyl)phenyl]ethyl]-3-[[6-(trifluoromethyl)-2-pyridinyl]methyl]urea |
| SMILES | O=C(NCCc1ccccc1C(F)(F)F)NCc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H15F6N3O/c18-16(19,20)13-6-2-1-4-11(13)8-9-24-15(27)25-10-12-5-3-7-14(26-12)17(21,22)23/h1-7H,8-10H2,(H2,24,25,27) |
| InChIKey | PUNNOSMMPUHPJD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |