C18H22N2O4S — CID 166256774
2-(1-ethenylcyclohexyl)-N-(1,1,3-trioxo-4H-1λ6,4-benzothiazin-7-yl)acetamide (PubChem CID 166256774) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-(1-ethenylcyclohexyl)-N-(1,1,3-trioxo-4H-1λ6,4-benzothiazin-7-yl)acetamide.
| Compound Name | 2-(1-ethenylcyclohexyl)-N-(1,1,3-trioxo-4H-1λ6,4-benzothiazin-7-yl)acetamide |
|---|---|
| PubChem CID | 166256774 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-(1-ethenylcyclohexyl)-N-(1,1,3-trioxo-4H-1λ6,4-benzothiazin-7-yl)acetamide |
| SMILES | C=CC1(CC(=O)Nc2ccc3c(c2)S(=O)(=O)CC(=O)N3)CCCCC1 |
| InChI | InChI=1S/C18H22N2O4S/c1-2-18(8-4-3-5-9-18)11-16(21)19-13-6-7-14-15(10-13)25(23,24)12-17(22)20-14/h2,6-7,10H,1,3-5,8-9,11-12H2,(H,19,21)(H,20,22) |
| InChIKey | ZXYNKTQOGFMDAV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|