C9H10F2N2S — CID 166257459
2-[4-(difluoromethylidene)piperidin-1-yl]-1,3-thiazole (PubChem CID 166257459) has the molecular formula C9H10F2N2S and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-[4-(difluoromethylidene)piperidin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-(difluoromethylidene)piperidin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 166257459 |
| Molecular Formula | C9H10F2N2S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-[4-(difluoromethylidene)piperidin-1-yl]-1,3-thiazole |
| SMILES | FC(F)=C1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C9H10F2N2S/c10-8(11)7-1-4-13(5-2-7)9-12-3-6-14-9/h3,6H,1-2,4-5H2 |
| InChIKey | WESNYFOPDCGCAN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |