C13H19N3O4S — CID 166259306
(4aR,7aS)-4-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b][1,4]oxazine (PubChem CID 166259306) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is (4aR,7aS)-4-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aS)-4-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 166259306 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (4aR,7aS)-4-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b][1,4]oxazine |
| SMILES | Cn1nc(C2CC2)cc1S(=O)(=O)N1CCO[C@@H]2COC[C@H]21 |
| InChI | InChI=1S/C13H19N3O4S/c1-15-13(6-10(14-15)9-2-3-9)21(17,18)16-4-5-20-12-8-19-7-11(12)16/h6,9,11-12H,2-5,7-8H2,1H3/t11-,12-/m1/s1 |
| InChIKey | VWURIIBQVAKLLV-VXGBXAGGSA-N |
| XLogP | 0.09 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |