C14H22N4O2S — CID 175980942
(3aS,6aR)-2-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 175980942) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is (3aS,6aR)-2-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aS,6aR)-2-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 175980942 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (3aS,6aR)-2-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Cn1nc(C2CC2)cc1S(=O)(=O)N1C[C@H]2CC(N)C[C@H]2C1 |
| InChI | InChI=1S/C14H22N4O2S/c1-17-14(6-13(16-17)9-2-3-9)21(19,20)18-7-10-4-12(15)5-11(10)8-18/h6,9-12H,2-5,7-8,15H2,1H3/t10-,11+,12? |
| InChIKey | YHOPECYFMREAPL-FOSCPWQOSA-N |
| XLogP | 0.66 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |