C11H14N4O — CID 166259597
3,6-dihydro-2H-pyridin-1-yl-[1-(triazol-1-yl)cyclopropyl]methanone (PubChem CID 166259597) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridin-1-yl-[1-(triazol-1-yl)cyclopropyl]methanone.
| Compound Name | 3,6-dihydro-2H-pyridin-1-yl-[1-(triazol-1-yl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 166259597 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3,6-dihydro-2H-pyridin-1-yl-[1-(triazol-1-yl)cyclopropyl]methanone |
| SMILES | O=C(N1CC=CCC1)C1(n2ccnn2)CC1 |
| InChI | InChI=1S/C11H14N4O/c16-10(14-7-2-1-3-8-14)11(4-5-11)15-9-6-12-13-15/h1-2,6,9H,3-5,7-8H2 |
| InChIKey | TYPGWMURJVCADP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|