C13H12F4N2O3S — CID 166264667
N-(3-cyanooxolan-3-yl)-3-fluoro-N-methyl-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 166264667) has the molecular formula C13H12F4N2O3S and a molecular weight of 352.31 g/mol. Its IUPAC name is N-(3-cyanooxolan-3-yl)-3-fluoro-N-methyl-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3-cyanooxolan-3-yl)-3-fluoro-N-methyl-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 166264667 |
| Molecular Formula | C13H12F4N2O3S |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | N-(3-cyanooxolan-3-yl)-3-fluoro-N-methyl-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(C1(C#N)CCOC1)S(=O)(=O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F4N2O3S/c1-19(12(7-18)2-3-22-8-12)23(20,21)11-5-9(13(15,16)17)4-10(14)6-11/h4-6H,2-3,8H2,1H3 |
| InChIKey | RLZKTVZXYSNBID-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |