C10H11ClN2O3S2 — CID 75478474
5-chloro-N-(3-cyanooxolan-3-yl)-N-methylthiophene-2-sulfonamide (PubChem CID 75478474) has the molecular formula C10H11ClN2O3S2 and a molecular weight of 306.80 g/mol. Its IUPAC name is 5-chloro-N-(3-cyanooxolan-3-yl)-N-methylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(3-cyanooxolan-3-yl)-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 75478474 |
| Molecular Formula | C10H11ClN2O3S2 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 5-chloro-N-(3-cyanooxolan-3-yl)-N-methylthiophene-2-sulfonamide |
| SMILES | CN(C1(C#N)CCOC1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H11ClN2O3S2/c1-13(10(6-12)4-5-16-7-10)18(14,15)9-3-2-8(11)17-9/h2-3H,4-5,7H2,1H3 |
| InChIKey | BEZUZYJHZSQIQM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |