C15H21N3O6S2 — CID 97309005
N-[(3R)-3-cyanooxolan-3-yl]-4-(ethylsulfonylamino)-2-methoxy-N-methylbenzenesulfonamide (PubChem CID 97309005) has the molecular formula C15H21N3O6S2 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-[(3R)-3-cyanooxolan-3-yl]-4-(ethylsulfonylamino)-2-methoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[(3R)-3-cyanooxolan-3-yl]-4-(ethylsulfonylamino)-2-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 97309005 |
| Molecular Formula | C15H21N3O6S2 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-[(3R)-3-cyanooxolan-3-yl]-4-(ethylsulfonylamino)-2-methoxy-N-methylbenzenesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(S(=O)(=O)N(C)[C@@]2(C#N)CCOC2)c(OC)c1 |
| InChI | InChI=1S/C15H21N3O6S2/c1-4-25(19,20)17-12-5-6-14(13(9-12)23-3)26(21,22)18(2)15(10-16)7-8-24-11-15/h5-6,9,17H,4,7-8,11H2,1-3H3/t15-/m1/s1 |
| InChIKey | FZFDAUKJEPRDNH-OAHLLOKOSA-N |
| XLogP | 0.76 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |